C24H21N3O — CID 2311113
3-(4-ethoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]benzimidazole (PubChem CID 2311113) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]benzimidazole.
| Compound Name | 3-(4-ethoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 2311113 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-(4-ethoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]benzimidazole |
| SMILES | CCOc1ccc(-n2c(-c3ccc(C)cc3)cn3c4ccccc4nc23)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-3-28-20-14-12-19(13-15-20)27-23(18-10-8-17(2)9-11-18)16-26-22-7-5-4-6-21(22)25-24(26)27/h4-16H,3H2,1-2H3 |
| InChIKey | FTVPXIDUOHVTJU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |