About [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate
[[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate (PubChem CID 2311150) has the molecular formula C11H9N3O4S
and a molecular weight of 279.28 g/mol. Its IUPAC name is [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate.
Molecular Properties
| Compound Name | [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate |
| PubChem CID | 2311150 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate |
| SMILES | Cc1csc(C(=NOC(=O)c2ccco2)C(N)=O)n1 |
| InChI | InChI=1S/C11H9N3O4S/c1-6-5-19-10(13-6)8(9(12)15)14-18-11(16)7-3-2-4-17-7/h2-5H,1H3,(H2,12,15) |
| InChIKey | VZMCGFXEOVIGQX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate?
The IUPAC name of [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate (CID 2311150) is [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate.
What is the SMILES notation for [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate?
The canonical SMILES for [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate is Cc1csc(C(=NOC(=O)c2ccco2)C(N)=O)n1.
What is the InChIKey of [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate?
The InChIKey is VZMCGFXEOVIGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O4S/c1-6-5-19-10(13-6)8(9(12)15)14-18-11(16)7-3-2-4-17-7/h2-5H,1H3,(H2,12,15).
What are the key properties of [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate?
[[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate has a molecular weight of 279.28 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-amino-1-(4-methyl-1,3-thiazol-2-yl)-2-oxoethylidene]amino] furan-2-carboxylate is sourced from PubChem (CID 2311150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).