About (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol
(2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol (PubChem CID 23111740) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol.
Molecular Properties
| Compound Name | (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol |
| PubChem CID | 23111740 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol |
| SMILES | OCc1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C8H7N3OS/c12-4-6-5-13-8(11-6)7-3-9-1-2-10-7/h1-3,5,12H,4H2 |
| InChIKey | FEZRHXOTTFDURA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol?
The IUPAC name of (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol (CID 23111740) is (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol.
What is the SMILES notation for (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol?
The canonical SMILES for (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol is OCc1csc(-c2cnccn2)n1.
What is the InChIKey of (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol?
The InChIKey is FEZRHXOTTFDURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c12-4-6-5-13-8(11-6)7-3-9-1-2-10-7/h1-3,5,12H,4H2.
What are the key properties of (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol?
(2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol has a molecular weight of 193.23 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanol is sourced from PubChem (CID 23111740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).