C26H15NO4 — CID 2311188
12-(4-hydroxy-3-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene-10,14-dione (PubChem CID 2311188) has the molecular formula C26H15NO4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 12-(4-hydroxy-3-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene-10,14-dione.
| Compound Name | 12-(4-hydroxy-3-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene-10,14-dione |
|---|---|
| PubChem CID | 2311188 |
| Molecular Formula | C26H15NO4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 12-(4-hydroxy-3-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene-10,14-dione |
| SMILES | COc1cc(-c2c3c(=O)c4ccccc4c3nc3c2c(=O)c2ccccc23)ccc1O |
| InChI | InChI=1S/C26H15NO4/c1-31-19-12-13(10-11-18(19)28)20-21-23(14-6-2-4-8-16(14)25(21)29)27-24-15-7-3-5-9-17(15)26(30)22(20)24/h2-12,28H,1H3 |
| InChIKey | QTIYOTGNEZWUQL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |