C7H13N3O3 — CID 23112529
1-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione (PubChem CID 23112529) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 23112529 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
| SMILES | CCCCN1C(=O)NC(=O)NC1O |
| InChI | InChI=1S/C7H13N3O3/c1-2-3-4-10-6(12)8-5(11)9-7(10)13/h6,12H,2-4H2,1H3,(H2,8,9,11,13) |
| InChIKey | HHCNRDJYEVBDLT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |