C19H9F5N2O2 — CID 23112875
9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 23112875) has the molecular formula C19H9F5N2O2 and a molecular weight of 392.28 g/mol. Its IUPAC name is 9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 23112875 |
| Molecular Formula | C19H9F5N2O2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c3ccccc3n(Cc3c(F)c(F)c(F)c(F)c3F)c2cn1 |
| InChI | InChI=1S/C19H9F5N2O2/c20-14-10(15(21)17(23)18(24)16(14)22)7-26-12-4-2-1-3-8(12)9-5-11(19(27)28)25-6-13(9)26/h1-6H,7H2,(H,27,28) |
| InChIKey | YYVVWLNDRHYKLQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|