C14H28N4 — CID 23113041
1,2-di(piperidin-4-yl)piperazine (PubChem CID 23113041) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is 1,2-di(piperidin-4-yl)piperazine.
| Compound Name | 1,2-di(piperidin-4-yl)piperazine |
|---|---|
| PubChem CID | 23113041 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1,2-di(piperidin-4-yl)piperazine |
| SMILES | C1CC(C2CNCCN2C2CCNCC2)CCN1 |
| InChI | InChI=1S/C14H28N4/c1-5-15-6-2-12(1)14-11-17-9-10-18(14)13-3-7-16-8-4-13/h12-17H,1-11H2 |
| InChIKey | YRQUPRLADZCJDV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |