About 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate
4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 2311321) has the molecular formula C11H6N3O3-
and a molecular weight of 228.19 g/mol. Its IUPAC name is 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate.
Molecular Properties
| Compound Name | 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
| PubChem CID | 2311321 |
| Molecular Formula | C11H6N3O3- |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | O=C([O-])c1cnc2[nH]c3ccccc3n2c1=O |
| InChI | InChI=1S/C11H7N3O3/c15-9-6(10(16)17)5-12-11-13-7-3-1-2-4-8(7)14(9)11/h1-5H,(H,12,13)(H,16,17)/p-1 |
| InChIKey | MEOBJJZNXULJDE-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate?
The IUPAC name of 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate (CID 2311321) is 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate.
What is the SMILES notation for 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate?
The canonical SMILES for 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate is O=C([O-])c1cnc2[nH]c3ccccc3n2c1=O.
What is the InChIKey of 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate?
The InChIKey is MEOBJJZNXULJDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H7N3O3/c15-9-6(10(16)17)5-12-11-13-7-3-1-2-4-8(7)14(9)11/h1-5H,(H,12,13)(H,16,17)/p-1.
What are the key properties of 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate?
4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate has a molecular weight of 228.19 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-10H-pyrimido[1,2-a]benzimidazole-3-carboxylate is sourced from PubChem (CID 2311321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).