C18H28O2 — CID 23113228
3,8-dimethyl-1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane (PubChem CID 23113228) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 3,8-dimethyl-1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane.
| Compound Name | 3,8-dimethyl-1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 23113228 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 3,8-dimethyl-1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
| SMILES | C=CCOC1CC2C3CC(OCC=C)(CC3C)C2C1C |
| InChI | InChI=1S/C18H28O2/c1-5-7-19-16-9-14-15-11-18(10-12(15)3,20-8-6-2)17(14)13(16)4/h5-6,12-17H,1-2,7-11H2,3-4H3 |
| InChIKey | WTYNJAWFEOBDFC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|