About 7-ethyladamantane-1,3,5-triol
7-ethyladamantane-1,3,5-triol (PubChem CID 23113234) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 7-ethyladamantane-1,3,5-triol.
Molecular Properties
| Compound Name | 7-ethyladamantane-1,3,5-triol |
| PubChem CID | 23113234 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 7-ethyladamantane-1,3,5-triol |
| SMILES | CCC12CC3(O)CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H20O3/c1-2-9-3-10(13)6-11(14,4-9)8-12(15,5-9)7-10/h13-15H,2-8H2,1H3 |
| InChIKey | RLGHCRMGWMGWSA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethyladamantane-1,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyladamantane-1,3,5-triol?
The IUPAC name of 7-ethyladamantane-1,3,5-triol (CID 23113234) is 7-ethyladamantane-1,3,5-triol.
What is the SMILES notation for 7-ethyladamantane-1,3,5-triol?
The canonical SMILES for 7-ethyladamantane-1,3,5-triol is CCC12CC3(O)CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of 7-ethyladamantane-1,3,5-triol?
The InChIKey is RLGHCRMGWMGWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-2-9-3-10(13)6-11(14,4-9)8-12(15,5-9)7-10/h13-15H,2-8H2,1H3.
What are the key properties of 7-ethyladamantane-1,3,5-triol?
7-ethyladamantane-1,3,5-triol has a molecular weight of 212.29 g/mol, XLogP of 0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyladamantane-1,3,5-triol is sourced from PubChem (CID 23113234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).