C19H28O3 — CID 23113253
1,4,8-tris(prop-2-enoxy)tricyclo[5.2.1.02,6]decane (PubChem CID 23113253) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1,4,8-tris(prop-2-enoxy)tricyclo[5.2.1.02,6]decane.
| Compound Name | 1,4,8-tris(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 23113253 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1,4,8-tris(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
| SMILES | C=CCOC1CC2C3CC(OCC=C)(CC3OCC=C)C2C1 |
| InChI | InChI=1S/C19H28O3/c1-4-7-20-14-10-15-16-12-19(17(15)11-14,22-9-6-3)13-18(16)21-8-5-2/h4-6,14-18H,1-3,7-13H2 |
| InChIKey | AHOAKBWHYJWEOT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|