About 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane
1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane (PubChem CID 23113259) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
| PubChem CID | 23113259 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane |
| SMILES | C=CCOC1CC2C3CCC(OCC=C)(C3)C2C1 |
| InChI | InChI=1S/C16H24O2/c1-3-7-17-13-9-14-12-5-6-16(11-12,15(14)10-13)18-8-4-2/h3-4,12-15H,1-2,5-11H2 |
| InChIKey | YSMSOEIYSXPOSV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane?
The IUPAC name of 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane (CID 23113259) is 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane?
The canonical SMILES for 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane is C=CCOC1CC2C3CCC(OCC=C)(C3)C2C1.
What is the InChIKey of 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane?
The InChIKey is YSMSOEIYSXPOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c1-3-7-17-13-9-14-12-5-6-16(11-12,15(14)10-13)18-8-4-2/h3-4,12-15H,1-2,5-11H2.
What are the key properties of 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane?
1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane has a molecular weight of 248.37 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(prop-2-enoxy)tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 23113259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).