C23H22FN5O — CID 23113311
4-[(4-fluorophenyl)methyl]-11-phenyl-8-propyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,9-trien-7-one (PubChem CID 23113311) has the molecular formula C23H22FN5O and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-11-phenyl-8-propyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,9-trien-7-one.
| Compound Name | 4-[(4-fluorophenyl)methyl]-11-phenyl-8-propyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,9-trien-7-one |
|---|---|
| PubChem CID | 23113311 |
| Molecular Formula | C23H22FN5O |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-11-phenyl-8-propyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,9-trien-7-one |
| SMILES | CCCN1C(=O)N2CC(Cc3ccc(F)cc3)N=C2c2cn(-c3ccccc3)nc21 |
| InChI | InChI=1S/C23H22FN5O/c1-2-12-27-22-20(15-29(26-22)19-6-4-3-5-7-19)21-25-18(14-28(21)23(27)30)13-16-8-10-17(24)11-9-16/h3-11,15,18H,2,12-14H2,1H3 |
| InChIKey | QQPRNPREEVZUCJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |