About 4,5-diisocyanato-1,3-dithiane
4,5-diisocyanato-1,3-dithiane (PubChem CID 23113467) has the molecular formula C6H6N2O2S2
and a molecular weight of 202.26 g/mol. Its IUPAC name is 4,5-diisocyanato-1,3-dithiane.
Molecular Properties
| Compound Name | 4,5-diisocyanato-1,3-dithiane |
| PubChem CID | 23113467 |
| Molecular Formula | C6H6N2O2S2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | 4,5-diisocyanato-1,3-dithiane |
| SMILES | O=C=NC1CSCSC1N=C=O |
| InChI | InChI=1S/C6H6N2O2S2/c9-2-7-5-1-11-4-12-6(5)8-3-10/h5-6H,1,4H2 |
| InChIKey | GRFBPDBYMMVQRG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diisocyanato-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diisocyanato-1,3-dithiane?
The IUPAC name of 4,5-diisocyanato-1,3-dithiane (CID 23113467) is 4,5-diisocyanato-1,3-dithiane.
What is the SMILES notation for 4,5-diisocyanato-1,3-dithiane?
The canonical SMILES for 4,5-diisocyanato-1,3-dithiane is O=C=NC1CSCSC1N=C=O.
What is the InChIKey of 4,5-diisocyanato-1,3-dithiane?
The InChIKey is GRFBPDBYMMVQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2S2/c9-2-7-5-1-11-4-12-6(5)8-3-10/h5-6H,1,4H2.
What are the key properties of 4,5-diisocyanato-1,3-dithiane?
4,5-diisocyanato-1,3-dithiane has a molecular weight of 202.26 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diisocyanato-1,3-dithiane is sourced from PubChem (CID 23113467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).