C27H28N4O3 — CID 23113605
6-(3,5-dimethoxyphenyl)-N-(3,5-dimethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide (PubChem CID 23113605) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-N-(3,5-dimethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide.
| Compound Name | 6-(3,5-dimethoxyphenyl)-N-(3,5-dimethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 23113605 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-N-(3,5-dimethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide |
| SMILES | COc1cc(OC)cc(C2c3[nH]c4ncccc4c3CCN2C(=O)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-16-10-17(2)12-19(11-16)29-27(32)31-9-7-22-23-6-5-8-28-26(23)30-24(22)25(31)18-13-20(33-3)15-21(14-18)34-4/h5-6,8,10-15,25H,7,9H2,1-4H3,(H,28,30)(H,29,32) |
| InChIKey | MDMJPTOIMZOGED-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |