About 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole
1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole (PubChem CID 23113700) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole |
| PubChem CID | 23113700 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole |
| SMILES | CC1=C2N=c3ccccc3=C2CCN1C |
| InChI | InChI=1S/C13H14N2/c1-9-13-11(7-8-15(9)2)10-5-3-4-6-12(10)14-13/h3-6H,7-8H2,1-2H3 |
| InChIKey | YENZKWVJZZSALP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole?
The IUPAC name of 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole (CID 23113700) is 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole.
What is the SMILES notation for 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole?
The canonical SMILES for 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole is CC1=C2N=c3ccccc3=C2CCN1C.
What is the InChIKey of 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole?
The InChIKey is YENZKWVJZZSALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2/c1-9-13-11(7-8-15(9)2)10-5-3-4-6-12(10)14-13/h3-6H,7-8H2,1-2H3.
What are the key properties of 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole?
1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole has a molecular weight of 198.27 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3,4-dihydropyrido[3,4-b]indole is sourced from PubChem (CID 23113700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).