C20H18FN3O2 — CID 23113758
methyl 6-(3-fluorophenyl)spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,1'-cyclopropane]-5-carboxylate (PubChem CID 23113758) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is methyl 6-(3-fluorophenyl)spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,1'-cyclopropane]-5-carboxylate.
| Compound Name | methyl 6-(3-fluorophenyl)spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,1'-cyclopropane]-5-carboxylate |
|---|---|
| PubChem CID | 23113758 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl 6-(3-fluorophenyl)spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,1'-cyclopropane]-5-carboxylate |
| SMILES | COC(=O)N1CC2(CC2)c2c([nH]c3ncccc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C20H18FN3O2/c1-26-19(25)24-11-20(7-8-20)15-14-6-3-9-22-18(14)23-16(15)17(24)12-4-2-5-13(21)10-12/h2-6,9-10,17H,7-8,11H2,1H3,(H,22,23) |
| InChIKey | LACSRYAOROWEFR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |