C19H17FN4O2 — CID 23113777
methyl 10-(3-fluorophenyl)spiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopropane]-11-carboxylate (PubChem CID 23113777) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is methyl 10-(3-fluorophenyl)spiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopropane]-11-carboxylate.
| Compound Name | methyl 10-(3-fluorophenyl)spiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopropane]-11-carboxylate |
|---|---|
| PubChem CID | 23113777 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | methyl 10-(3-fluorophenyl)spiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopropane]-11-carboxylate |
| SMILES | COC(=O)N1CC2(CC2)c2c([nH]c3cncnc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C19H17FN4O2/c1-26-18(25)24-9-19(5-6-19)14-15-13(8-21-10-22-15)23-16(14)17(24)11-3-2-4-12(20)7-11/h2-4,7-8,10,17,23H,5-6,9H2,1H3 |
| InChIKey | PRMJVZIJEFTBML-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |