About 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran
5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran (PubChem CID 23113979) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 23113979 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc2c(c(C)c1Br)CCO2 |
| InChI | InChI=1S/C10H11BrO/c1-6-5-9-8(3-4-12-9)7(2)10(6)11/h5H,3-4H2,1-2H3 |
| InChIKey | DZQZGBYJABNTRU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran (CID 23113979) is 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran is Cc1cc2c(c(C)c1Br)CCO2.
What is the InChIKey of 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The InChIKey is DZQZGBYJABNTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO/c1-6-5-9-8(3-4-12-9)7(2)10(6)11/h5H,3-4H2,1-2H3.
What are the key properties of 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran?
5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran has a molecular weight of 227.10 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,6-dimethyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 23113979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).