C11H14N2O — CID 2311431
N-[[(2S)-oxolan-2-yl]methyl]-1-pyridin-3-ylmethanimine (PubChem CID 2311431) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-1-pyridin-3-ylmethanimine.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-1-pyridin-3-ylmethanimine |
|---|---|
| PubChem CID | 2311431 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-1-pyridin-3-ylmethanimine |
| SMILES | C(=N/C[C@@H]1CCCO1)\c1cccnc1 |
| InChI | InChI=1S/C11H14N2O/c1-3-10(7-12-5-1)8-13-9-11-4-2-6-14-11/h1,3,5,7-8,11H,2,4,6,9H2/b13-8+/t11-/m0/s1 |
| InChIKey | VXOSXMBPJMLJKX-ZWSXMNCCSA-N |
| XLogP | 1.68 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|