C21H14ClF2NO4S — CID 23114614
(E)-3-[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 23114614) has the molecular formula C21H14ClF2NO4S and a molecular weight of 449.86 g/mol. Its IUPAC name is (E)-3-[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23114614 |
| Molecular Formula | C21H14ClF2NO4S |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (E)-3-[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C21H14ClF2NO4S/c22-14-3-6-16(7-4-14)30(28,29)21(17-11-15(23)5-8-18(17)24)19-9-1-13(12-25-19)2-10-20(26)27/h1-12,21H,(H,26,27)/b10-2+ |
| InChIKey | WKMGTFJMUMZTBU-WTDSWWLTSA-N |
| XLogP | 4.67 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|