About 9-chloro-9H-fluorene
9-chloro-9H-fluorene (PubChem CID 23115) has the molecular formula C13H9Cl
and a molecular weight of 200.67 g/mol. Its IUPAC name is 9-chloro-9H-fluorene.
Molecular Properties
| Compound Name | 9-chloro-9H-fluorene |
| PubChem CID | 23115 |
| Molecular Formula | C13H9Cl |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 9-chloro-9H-fluorene |
| SMILES | ClC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H9Cl/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H |
| InChIKey | CVCQMAKDIKSUHX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-9H-fluorene?
The IUPAC name of 9-chloro-9H-fluorene (CID 23115) is 9-chloro-9H-fluorene.
What is the SMILES notation for 9-chloro-9H-fluorene?
The canonical SMILES for 9-chloro-9H-fluorene is ClC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9-chloro-9H-fluorene?
The InChIKey is CVCQMAKDIKSUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H.
What are the key properties of 9-chloro-9H-fluorene?
9-chloro-9H-fluorene has a molecular weight of 200.67 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-9H-fluorene is sourced from PubChem (CID 23115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).