1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride

C7H16FNO — CID 23116033

IUPAC1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride
SMILESCOC[N+]1(C)CCCC1.[F-]
InChIInChI=1S/C7H16NO.FH/c1-8(7-9-2)5-3-4-6-8;/h3-7H2,1-2H3;1H/q+1;/p-1
InChIKeyOFRIOBDEWZDLFM-UHFFFAOYSA-M
MW149.21 g/mol
LogP-2.17
Rot. Bonds2

About 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride

1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride (PubChem CID 23116033) has the molecular formula C7H16FNO and a molecular weight of 149.21 g/mol. Its IUPAC name is 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride.

Molecular Properties

Compound Name1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride
PubChem CID23116033
Molecular FormulaC7H16FNO
Molecular Weight149.21 g/mol
Exact Mass149.12
IUPAC Name1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride
SMILESCOC[N+]1(C)CCCC1.[F-]
InChIInChI=1S/C7H16NO.FH/c1-8(7-9-2)5-3-4-6-8;/h3-7H2,1-2H3;1H/q+1;/p-1
InChIKeyOFRIOBDEWZDLFM-UHFFFAOYSA-M
XLogP-2.17
TPSA9.23 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.21
LogP ≤ 5-2.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride?
The IUPAC name of 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride (CID 23116033) is 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride.
What is the SMILES notation for 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride?
The canonical SMILES for 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride is COC[N+]1(C)CCCC1.[F-].
What is the InChIKey of 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride?
The InChIKey is OFRIOBDEWZDLFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16NO.FH/c1-8(7-9-2)5-3-4-6-8;/h3-7H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride?
1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride has a molecular weight of 149.21 g/mol, XLogP of -2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-1-methylpyrrolidin-1-ium fluoride is sourced from PubChem (CID 23116033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).