C25H29NO7 — CID 23116282
4-[2-ethyl-3,5-dihydroxy-6-(4-methoxybenzoyl)phenyl]-1-[2-(hydroxymethyl)pyrrolidin-1-yl]butane-1,3-dione (PubChem CID 23116282) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[2-ethyl-3,5-dihydroxy-6-(4-methoxybenzoyl)phenyl]-1-[2-(hydroxymethyl)pyrrolidin-1-yl]butane-1,3-dione.
| Compound Name | 4-[2-ethyl-3,5-dihydroxy-6-(4-methoxybenzoyl)phenyl]-1-[2-(hydroxymethyl)pyrrolidin-1-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 23116282 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[2-ethyl-3,5-dihydroxy-6-(4-methoxybenzoyl)phenyl]-1-[2-(hydroxymethyl)pyrrolidin-1-yl]butane-1,3-dione |
| SMILES | CCc1c(O)cc(O)c(C(=O)c2ccc(OC)cc2)c1CC(=O)CC(=O)N1CCCC1CO |
| InChI | InChI=1S/C25H29NO7/c1-3-19-20(11-17(28)12-23(31)26-10-4-5-16(26)14-27)24(22(30)13-21(19)29)25(32)15-6-8-18(33-2)9-7-15/h6-9,13,16,27,29-30H,3-5,10-12,14H2,1-2H3 |
| InChIKey | VWWNFBOLUQFHIH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|