C28H38O9 — CID 23116318
[2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]ethyl]-3-ethyl-4,6-bis(methoxymethoxy)phenyl]-(4-methoxyphenyl)methanone (PubChem CID 23116318) has the molecular formula C28H38O9 and a molecular weight of 518.60 g/mol. Its IUPAC name is [2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]ethyl]-3-ethyl-4,6-bis(methoxymethoxy)phenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]ethyl]-3-ethyl-4,6-bis(methoxymethoxy)phenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 23116318 |
| Molecular Formula | C28H38O9 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]ethyl]-3-ethyl-4,6-bis(methoxymethoxy)phenyl]-(4-methoxyphenyl)methanone |
| SMILES | CCc1c(OCOC)cc(OCOC)c(C(=O)c2ccc(OC)cc2)c1CCOCC1COC(C)(C)O1 |
| InChI | InChI=1S/C28H38O9/c1-7-22-23(12-13-33-15-21-16-36-28(2,3)37-21)26(27(29)19-8-10-20(32-6)11-9-19)25(35-18-31-5)14-24(22)34-17-30-4/h8-11,14,21H,7,12-13,15-18H2,1-6H3 |
| InChIKey | HUZBYVDUTGAYOG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|