C22H24NO2PS — CID 2311649
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide (PubChem CID 2311649) has the molecular formula C22H24NO2PS and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide |
|---|---|
| PubChem CID | 2311649 |
| Molecular Formula | C22H24NO2PS |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide |
| SMILES | C[C@H]1CN(P2(=O)C=C(c3ccccc3)SC(c3ccccc3)=C2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H24NO2PS/c1-17-13-23(14-18(2)25-17)26(24)15-21(19-9-5-3-6-10-19)27-22(16-26)20-11-7-4-8-12-20/h3-12,15-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | ZPQNFGPWDSOKLV-ROUUACIJSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|