C12H16N4O2 — CID 23116537
6-(4-aminobutan-2-ylamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 23116537) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 6-(4-aminobutan-2-ylamino)-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-(4-aminobutan-2-ylamino)-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 23116537 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-(4-aminobutan-2-ylamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CC(CCN)Nc1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C12H16N4O2/c1-7(4-5-13)14-8-2-3-9-10(6-8)12(18)16-15-11(9)17/h2-3,6-7,14H,4-5,13H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | PPKNIJDNMPPBJC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |