(Z)-3,4,4,4-tetrafluorobut-2-enoic acid

C4H2F4O2 — CID 23116759

IUPAC(Z)-3,4,4,4-tetrafluorobut-2-enoic acid
SMILESO=C(O)/C=C(\F)C(F)(F)F
InChIInChI=1S/C4H2F4O2/c5-2(1-3(9)10)4(6,7)8/h1H,(H,9,10)/b2-1-
InChIKeyWKAYWQKZZYEPTI-UPHRSURJSA-N
MW158.05 g/mol
LogP1.49
Rot. Bonds1

About (Z)-3,4,4,4-tetrafluorobut-2-enoic acid

(Z)-3,4,4,4-tetrafluorobut-2-enoic acid (PubChem CID 23116759) has the molecular formula C4H2F4O2 and a molecular weight of 158.05 g/mol. Its IUPAC name is (Z)-3,4,4,4-tetrafluorobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-3,4,4,4-tetrafluorobut-2-enoic acid
PubChem CID23116759
Molecular FormulaC4H2F4O2
Molecular Weight158.05 g/mol
Exact Mass158.00
IUPAC Name(Z)-3,4,4,4-tetrafluorobut-2-enoic acid
SMILESO=C(O)/C=C(\F)C(F)(F)F
InChIInChI=1S/C4H2F4O2/c5-2(1-3(9)10)4(6,7)8/h1H,(H,9,10)/b2-1-
InChIKeyWKAYWQKZZYEPTI-UPHRSURJSA-N
XLogP1.49
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.05
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-3,4,4,4-tetrafluorobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-3,4,4,4-tetrafluorobut-2-enoic acid?
The IUPAC name of (Z)-3,4,4,4-tetrafluorobut-2-enoic acid (CID 23116759) is (Z)-3,4,4,4-tetrafluorobut-2-enoic acid.
What is the SMILES notation for (Z)-3,4,4,4-tetrafluorobut-2-enoic acid?
The canonical SMILES for (Z)-3,4,4,4-tetrafluorobut-2-enoic acid is O=C(O)/C=C(\F)C(F)(F)F.
What is the InChIKey of (Z)-3,4,4,4-tetrafluorobut-2-enoic acid?
The InChIKey is WKAYWQKZZYEPTI-UPHRSURJSA-N. The full InChI is InChI=1S/C4H2F4O2/c5-2(1-3(9)10)4(6,7)8/h1H,(H,9,10)/b2-1-.
What are the key properties of (Z)-3,4,4,4-tetrafluorobut-2-enoic acid?
(Z)-3,4,4,4-tetrafluorobut-2-enoic acid has a molecular weight of 158.05 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4,4,4-tetrafluorobut-2-enoic acid is sourced from PubChem (CID 23116759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).