C16H18F2N4OS — CID 2311698
1-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine (PubChem CID 2311698) has the molecular formula C16H18F2N4OS and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine.
| Compound Name | 1-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine |
|---|---|
| PubChem CID | 2311698 |
| Molecular Formula | C16H18F2N4OS |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine |
| SMILES | FC(F)Oc1ccc(-c2csc(NNC3=NCCCCC3)n2)cc1 |
| InChI | InChI=1S/C16H18F2N4OS/c17-15(18)23-12-7-5-11(6-8-12)13-10-24-16(20-13)22-21-14-4-2-1-3-9-19-14/h5-8,10,15H,1-4,9H2,(H,19,21)(H,20,22) |
| InChIKey | ZBJRPDOVVBMPKG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|