About ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate
ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate (PubChem CID 23117358) has the molecular formula C15H15NO2S
and a molecular weight of 273.36 g/mol. Its IUPAC name is ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
| PubChem CID | 23117358 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)-c1cc(N)ccc1CC2 |
| InChI | InChI=1S/C15H15NO2S/c1-2-18-15(17)13-7-10-4-3-9-5-6-11(16)8-12(9)14(10)19-13/h5-8H,2-4,16H2,1H3 |
| InChIKey | FYHQGVHOPMAFJT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate?
The IUPAC name of ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate (CID 23117358) is ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate.
What is the SMILES notation for ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate?
The canonical SMILES for ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate is CCOC(=O)c1cc2c(s1)-c1cc(N)ccc1CC2.
What is the InChIKey of ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate?
The InChIKey is FYHQGVHOPMAFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c1-2-18-15(17)13-7-10-4-3-9-5-6-11(16)8-12(9)14(10)19-13/h5-8H,2-4,16H2,1H3.
What are the key properties of ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate?
ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate has a molecular weight of 273.36 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-amino-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate is sourced from PubChem (CID 23117358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).