C15H19F5O3 — CID 23118481
6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxan-4-ol (PubChem CID 23118481) has the molecular formula C15H19F5O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxan-4-ol.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxan-4-ol |
|---|---|
| PubChem CID | 23118481 |
| Molecular Formula | C15H19F5O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxan-4-ol |
| SMILES | CCCC1OC(C2CC3C=CC2C3)C(F)(F)C(O)(C(F)(F)F)O1 |
| InChI | InChI=1S/C15H19F5O3/c1-2-3-11-22-12(10-7-8-4-5-9(10)6-8)13(16,17)14(21,23-11)15(18,19)20/h4-5,8-12,21H,2-3,6-7H2,1H3 |
| InChIKey | WNZPFAPBDIZLLA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|