C26H25F5O5S2 — CID 23118488
2-carboxy-1,1-difluoro-3,3-dimethyl-2-(trifluoromethyl)butane-1-sulfonate;triphenylsulfanium (PubChem CID 23118488) has the molecular formula C26H25F5O5S2 and a molecular weight of 576.61 g/mol. Its IUPAC name is 2-carboxy-1,1-difluoro-3,3-dimethyl-2-(trifluoromethyl)butane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-carboxy-1,1-difluoro-3,3-dimethyl-2-(trifluoromethyl)butane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23118488 |
| Molecular Formula | C26H25F5O5S2 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 2-carboxy-1,1-difluoro-3,3-dimethyl-2-(trifluoromethyl)butane-1-sulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)C(C(=O)O)(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H11F5O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2,3)6(4(14)15,7(9,10)11)8(12,13)19(16,17)18/h1-15H;1-3H3,(H,14,15)(H,16,17,18)/q+1;/p-1 |
| InChIKey | IJAIYUGNFUREJW-UHFFFAOYSA-M |
| XLogP | 6.59 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|