About 6H-pyrido[1,2-a]indol-5-ium
6H-pyrido[1,2-a]indol-5-ium (PubChem CID 23118532) has the molecular formula C12H10N+
and a molecular weight of 168.22 g/mol. Its IUPAC name is 6H-pyrido[1,2-a]indol-5-ium.
Molecular Properties
| Compound Name | 6H-pyrido[1,2-a]indol-5-ium |
| PubChem CID | 23118532 |
| Molecular Formula | C12H10N+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 6H-pyrido[1,2-a]indol-5-ium |
| SMILES | C1=CC[N+]2=c3ccccc3=CC2=C1 |
| InChI | InChI=1S/C12H10N/c1-2-7-12-10(5-1)9-11-6-3-4-8-13(11)12/h1-7,9H,8H2/q+1 |
| InChIKey | KDXCCPFRJOPLNS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6H-pyrido[1,2-a]indol-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrido[1,2-a]indol-5-ium?
The IUPAC name of 6H-pyrido[1,2-a]indol-5-ium (CID 23118532) is 6H-pyrido[1,2-a]indol-5-ium.
What is the SMILES notation for 6H-pyrido[1,2-a]indol-5-ium?
The canonical SMILES for 6H-pyrido[1,2-a]indol-5-ium is C1=CC[N+]2=c3ccccc3=CC2=C1.
What is the InChIKey of 6H-pyrido[1,2-a]indol-5-ium?
The InChIKey is KDXCCPFRJOPLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N/c1-2-7-12-10(5-1)9-11-6-3-4-8-13(11)12/h1-7,9H,8H2/q+1.
What are the key properties of 6H-pyrido[1,2-a]indol-5-ium?
6H-pyrido[1,2-a]indol-5-ium has a molecular weight of 168.22 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrido[1,2-a]indol-5-ium is sourced from PubChem (CID 23118532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).