C25H22N2O — CID 23118670
1-[6-(1H-indol-3-yl)-6H-phenanthridin-5-yl]-2-methylpropan-1-one (PubChem CID 23118670) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[6-(1H-indol-3-yl)-6H-phenanthridin-5-yl]-2-methylpropan-1-one.
| Compound Name | 1-[6-(1H-indol-3-yl)-6H-phenanthridin-5-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 23118670 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[6-(1H-indol-3-yl)-6H-phenanthridin-5-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1c2ccccc2-c2ccccc2C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H22N2O/c1-16(2)25(28)27-23-14-8-6-11-19(23)17-9-3-4-12-20(17)24(27)21-15-26-22-13-7-5-10-18(21)22/h3-16,24,26H,1-2H3 |
| InChIKey | VRTDRTWHTPMYOE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |