C19H35NO4 — CID 23118783
(8,10-diethyl-3,3,8,10,11-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate (PubChem CID 23118783) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is (8,10-diethyl-3,3,8,10,11-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate.
| Compound Name | (8,10-diethyl-3,3,8,10,11-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate |
|---|---|
| PubChem CID | 23118783 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | (8,10-diethyl-3,3,8,10,11-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate |
| SMILES | CCC1(C)CC2(OCC(C)(C)CO2)C(C)C(C)(CC)N1OC(C)=O |
| InChI | InChI=1S/C19H35NO4/c1-9-17(7)11-19(22-12-16(5,6)13-23-19)14(3)18(8,10-2)20(17)24-15(4)21/h14H,9-13H2,1-8H3 |
| InChIKey | RGIAQSVQYPRKLA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |