About 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 23119547) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| PubChem CID | 23119547 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | C=COC(=O)C1C2C=CC(C2)C1C(=O)OCC |
| InChI | InChI=1S/C13H16O4/c1-3-16-12(14)10-8-5-6-9(7-8)11(10)13(15)17-4-2/h3,5-6,8-11H,1,4,7H2,2H3 |
| InChIKey | BLBSCAZAXVNWGT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 23119547) is 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is C=COC(=O)C1C2C=CC(C2)C1C(=O)OCC.
What is the InChIKey of 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is BLBSCAZAXVNWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-3-16-12(14)10-8-5-6-9(7-8)11(10)13(15)17-4-2/h3,5-6,8-11H,1,4,7H2,2H3.
What are the key properties of 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 236.27 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethenyl 2-O-ethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 23119547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).