C26H25N3O6S — CID 23120182
3-[3-[(6,9-dimethoxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)sulfonyl]phenyl]-1H-quinazoline-2,4-dione (PubChem CID 23120182) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is 3-[3-[(6,9-dimethoxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)sulfonyl]phenyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[3-[(6,9-dimethoxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)sulfonyl]phenyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 23120182 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 3-[3-[(6,9-dimethoxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)sulfonyl]phenyl]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(OC)c2c1CCCCN2S(=O)(=O)c1cccc(-n2c(=O)[nH]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C26H25N3O6S/c1-34-22-13-14-23(35-2)24-20(22)11-5-6-15-28(24)36(32,33)18-9-7-8-17(16-18)29-25(30)19-10-3-4-12-21(19)27-26(29)31/h3-4,7-10,12-14,16H,5-6,11,15H2,1-2H3,(H,27,31) |
| InChIKey | IPGXXJSDZUJWTF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |