About 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline
3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline (PubChem CID 2312058) has the molecular formula C21H14F2N4O2S
and a molecular weight of 424.43 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline |
| PubChem CID | 2312058 |
| Molecular Formula | C21H14F2N4O2S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline |
| SMILES | O=S(=O)(c1ccccc1)N1CN(c2ccc(F)cc2F)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H14F2N4O2S/c22-14-10-11-19(16(23)12-14)26-13-27(30(28,29)15-6-2-1-3-7-15)21-20(26)24-17-8-4-5-9-18(17)25-21/h1-12H,13H2 |
| InChIKey | RZPVJAQOZBEKNJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline?
The IUPAC name of 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline (CID 2312058) is 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline.
What is the SMILES notation for 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline?
The canonical SMILES for 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline is O=S(=O)(c1ccccc1)N1CN(c2ccc(F)cc2F)c2nc3ccccc3nc21.
What is the InChIKey of 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline?
The InChIKey is RZPVJAQOZBEKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F2N4O2S/c22-14-10-11-19(16(23)12-14)26-13-27(30(28,29)15-6-2-1-3-7-15)21-20(26)24-17-8-4-5-9-18(17)25-21/h1-12H,13H2.
What are the key properties of 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline?
3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline has a molecular weight of 424.43 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-1-(2,4-difluorophenyl)-2H-imidazo[4,5-b]quinoxaline is sourced from PubChem (CID 2312058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).