About 1,1,2-triethoxyethene
1,1,2-triethoxyethene (PubChem CID 23120612) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 1,1,2-triethoxyethene.
Molecular Properties
| Compound Name | 1,1,2-triethoxyethene |
| PubChem CID | 23120612 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1,1,2-triethoxyethene |
| SMILES | CCOC=C(OCC)OCC |
| InChI | InChI=1S/C8H16O3/c1-4-9-7-8(10-5-2)11-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | SKDYTPBHOGOVME-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-triethoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-triethoxyethene?
The IUPAC name of 1,1,2-triethoxyethene (CID 23120612) is 1,1,2-triethoxyethene.
What is the SMILES notation for 1,1,2-triethoxyethene?
The canonical SMILES for 1,1,2-triethoxyethene is CCOC=C(OCC)OCC.
What is the InChIKey of 1,1,2-triethoxyethene?
The InChIKey is SKDYTPBHOGOVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-4-9-7-8(10-5-2)11-6-3/h7H,4-6H2,1-3H3.
What are the key properties of 1,1,2-triethoxyethene?
1,1,2-triethoxyethene has a molecular weight of 160.21 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-triethoxyethene is sourced from PubChem (CID 23120612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).