About 3H-phenoxazine
3H-phenoxazine (PubChem CID 23120633) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3H-phenoxazine.
Molecular Properties
| Compound Name | 3H-phenoxazine |
| PubChem CID | 23120633 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 3H-phenoxazine |
| SMILES | C1=CC2=Nc3ccccc3OC2=CC1 |
| InChI | InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-3,5-8H,4H2 |
| InChIKey | MOLUAYHPIDORGD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-phenoxazine?
The IUPAC name of 3H-phenoxazine (CID 23120633) is 3H-phenoxazine.
What is the SMILES notation for 3H-phenoxazine?
The canonical SMILES for 3H-phenoxazine is C1=CC2=Nc3ccccc3OC2=CC1.
What is the InChIKey of 3H-phenoxazine?
The InChIKey is MOLUAYHPIDORGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-3,5-8H,4H2.
What are the key properties of 3H-phenoxazine?
3H-phenoxazine has a molecular weight of 183.21 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-phenoxazine is sourced from PubChem (CID 23120633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).