About N,N-dimethylmethanamine;ethane
N,N-dimethylmethanamine;ethane (PubChem CID 23120641) has the molecular formula C5H15N
and a molecular weight of 89.18 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;ethane |
| PubChem CID | 23120641 |
| Molecular Formula | C5H15N |
| Molecular Weight | 89.18 g/mol |
| Exact Mass | 89.12 |
| IUPAC Name | N,N-dimethylmethanamine;ethane |
| SMILES | CC.CN(C)C |
| InChI | InChI=1S/C3H9N.C2H6/c1-4(2)3;1-2/h1-3H3;1-2H3 |
| InChIKey | SKAHVLIZSVNOKU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;ethane?
The IUPAC name of N,N-dimethylmethanamine;ethane (CID 23120641) is N,N-dimethylmethanamine;ethane.
What is the SMILES notation for N,N-dimethylmethanamine;ethane?
The canonical SMILES for N,N-dimethylmethanamine;ethane is CC.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;ethane?
The InChIKey is SKAHVLIZSVNOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H6/c1-4(2)3;1-2/h1-3H3;1-2H3.
What are the key properties of N,N-dimethylmethanamine;ethane?
N,N-dimethylmethanamine;ethane has a molecular weight of 89.18 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;ethane is sourced from PubChem (CID 23120641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).