About 6-sulfonyl-1,3-diazinane-2,4-dione
6-sulfonyl-1,3-diazinane-2,4-dione (PubChem CID 23120775) has the molecular formula C4H4N2O4S
and a molecular weight of 176.15 g/mol. Its IUPAC name is 6-sulfonyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-sulfonyl-1,3-diazinane-2,4-dione |
| PubChem CID | 23120775 |
| Molecular Formula | C4H4N2O4S |
| Molecular Weight | 176.15 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | 6-sulfonyl-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(=S(=O)=O)NC(=O)N1 |
| InChI | InChI=1S/C4H4N2O4S/c7-2-1-3(11(9)10)6-4(8)5-2/h1H2,(H2,5,6,7,8) |
| InChIKey | KUSSMYMWXDKWLP-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.15 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfonyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfonyl-1,3-diazinane-2,4-dione?
The IUPAC name of 6-sulfonyl-1,3-diazinane-2,4-dione (CID 23120775) is 6-sulfonyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-sulfonyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-sulfonyl-1,3-diazinane-2,4-dione is O=C1CC(=S(=O)=O)NC(=O)N1.
What is the InChIKey of 6-sulfonyl-1,3-diazinane-2,4-dione?
The InChIKey is KUSSMYMWXDKWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O4S/c7-2-1-3(11(9)10)6-4(8)5-2/h1H2,(H2,5,6,7,8).
What are the key properties of 6-sulfonyl-1,3-diazinane-2,4-dione?
6-sulfonyl-1,3-diazinane-2,4-dione has a molecular weight of 176.15 g/mol, XLogP of -1.78, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfonyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 23120775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).