C6H4F10O — CID 23120850
1,1,2,2,3-pentafluoro-1-(1,1,2,2,3-pentafluoropropoxy)propane (PubChem CID 23120850) has the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-1-(1,1,2,2,3-pentafluoropropoxy)propane.
| Compound Name | 1,1,2,2,3-pentafluoro-1-(1,1,2,2,3-pentafluoropropoxy)propane |
|---|---|
| PubChem CID | 23120850 |
| Molecular Formula | C6H4F10O |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-1-(1,1,2,2,3-pentafluoropropoxy)propane |
| SMILES | FCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C6H4F10O/c7-1-3(9,10)5(13,14)17-6(15,16)4(11,12)2-8/h1-2H2 |
| InChIKey | GGUOSNSWXXRFBW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|