C18H13F17 — CID 23120854
1,2,2,3,3,4,4,5,5,6,7,8,9,10,11,12,12-heptadecafluorododecylbenzene (PubChem CID 23120854) has the molecular formula C18H13F17 and a molecular weight of 552.27 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,7,8,9,10,11,12,12-heptadecafluorododecylbenzene.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,7,8,9,10,11,12,12-heptadecafluorododecylbenzene |
|---|---|
| PubChem CID | 23120854 |
| Molecular Formula | C18H13F17 |
| Molecular Weight | 552.27 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,7,8,9,10,11,12,12-heptadecafluorododecylbenzene |
| SMILES | FC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)c1ccccc1 |
| InChI | InChI=1S/C18H13F17/c19-7(9(21)11(23)14(26)27)8(20)10(22)13(25)16(30,31)18(34,35)17(32,33)15(28,29)12(24)6-4-2-1-3-5-6/h1-5,7-14H |
| InChIKey | IXYMXAXKXQFHNI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.27 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|