C20H19N5OS2 — CID 2312086
(2E)-2-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2312086) has the molecular formula C20H19N5OS2 and a molecular weight of 409.54 g/mol. Its IUPAC name is (2E)-2-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2E)-2-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2312086 |
| Molecular Formula | C20H19N5OS2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2E)-2-[(5Z)-4-oxo-3-prop-2-enyl-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | C=CCn1c(=O)/c(=C/c2cccs2)s/c1=C(\C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H19N5OS2/c1-2-9-25-19(26)16(12-14-7-6-11-27-14)28-20(25)15(13-21)18-23-22-17-8-4-3-5-10-24(17)18/h2,6-7,11-12H,1,3-5,8-10H2/b16-12-,20-15+ |
| InChIKey | FTPZNTLPMHYUOW-MLTGRMFNSA-N |
| XLogP | 2.03 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|