C26H30N4O4 — CID 23121882
N-[2-[acetyl(prop-2-enyl)amino]ethyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (PubChem CID 23121882) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[2-[acetyl(prop-2-enyl)amino]ethyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide.
| Compound Name | N-[2-[acetyl(prop-2-enyl)amino]ethyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23121882 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[2-[acetyl(prop-2-enyl)amino]ethyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| SMILES | C=CCN(CCNC(=O)N1CCN2C(=O)OC(c3ccccc3)(c3ccccc3)C2C1)C(C)=O |
| InChI | InChI=1S/C26H30N4O4/c1-3-15-28(20(2)31)16-14-27-24(32)29-17-18-30-23(19-29)26(34-25(30)33,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h3-13,23H,1,14-19H2,2H3,(H,27,32) |
| InChIKey | DCQHOCKXMJKVLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|