C19H20N2O2 — CID 23122043
1,1-diphenyl-5,6,7,8,9,9a-hexahydro-[1,3]oxazolo[3,4-a][1,4]diazepin-3-one (PubChem CID 23122043) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1,1-diphenyl-5,6,7,8,9,9a-hexahydro-[1,3]oxazolo[3,4-a][1,4]diazepin-3-one.
| Compound Name | 1,1-diphenyl-5,6,7,8,9,9a-hexahydro-[1,3]oxazolo[3,4-a][1,4]diazepin-3-one |
|---|---|
| PubChem CID | 23122043 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1,1-diphenyl-5,6,7,8,9,9a-hexahydro-[1,3]oxazolo[3,4-a][1,4]diazepin-3-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)C2CNCCCN12 |
| InChI | InChI=1S/C19H20N2O2/c22-18-21-13-7-12-20-14-17(21)19(23-18,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17,20H,7,12-14H2 |
| InChIKey | UBZFCUUTNMIWGS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |