C11H23NO3 — CID 23122203
tert-butyl N-(4-hydroxypentyl)-N-methylcarbamate (PubChem CID 23122203) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxypentyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(4-hydroxypentyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 23122203 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl N-(4-hydroxypentyl)-N-methylcarbamate |
| SMILES | CC(O)CCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-9(13)7-6-8-12(5)10(14)15-11(2,3)4/h9,13H,6-8H2,1-5H3 |
| InChIKey | ZYHJACITZJJLIT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |