C10H11F5N+ — CID 23123203
methyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium (PubChem CID 23123203) has the molecular formula C10H11F5N+ and a molecular weight of 240.19 g/mol. Its IUPAC name is methyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium.
| Compound Name | methyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium |
|---|---|
| PubChem CID | 23123203 |
| Molecular Formula | C10H11F5N+ |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | methyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium |
| SMILES | CCC[NH+](C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5N/c1-3-4-16(2)10-8(14)6(12)5(11)7(13)9(10)15/h3-4H2,1-2H3/p+1 |
| InChIKey | MZJMYQCFNIZBAR-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|