C16H22F7P — CID 23123553
(1-fluorocyclohexa-2,4-dien-1-yl)-(1,1,2,2,3,3-hexafluorononyl)-methylphosphane (PubChem CID 23123553) has the molecular formula C16H22F7P and a molecular weight of 378.31 g/mol. Its IUPAC name is (1-fluorocyclohexa-2,4-dien-1-yl)-(1,1,2,2,3,3-hexafluorononyl)-methylphosphane.
| Compound Name | (1-fluorocyclohexa-2,4-dien-1-yl)-(1,1,2,2,3,3-hexafluorononyl)-methylphosphane |
|---|---|
| PubChem CID | 23123553 |
| Molecular Formula | C16H22F7P |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (1-fluorocyclohexa-2,4-dien-1-yl)-(1,1,2,2,3,3-hexafluorononyl)-methylphosphane |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)P(C)C1(F)C=CC=CC1 |
| InChI | InChI=1S/C16H22F7P/c1-3-4-5-9-12-14(18,19)15(20,21)16(22,23)24(2)13(17)10-7-6-8-11-13/h6-8,10H,3-5,9,11-12H2,1-2H3 |
| InChIKey | AXZNEGHFFQWAGY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|